C15H23NO6S2 — CID 102563351
N-[4-(2-hydroxyethylsulfonyl)-2-methylphenyl]-1-(oxan-2-yl)methanesulfonamide (PubChem CID 102563351) has the molecular formula C15H23NO6S2 and a molecular weight of 377.48 g/mol. Its IUPAC name is N-[4-(2-hydroxyethylsulfonyl)-2-methylphenyl]-1-(oxan-2-yl)methanesulfonamide.
| Compound Name | N-[4-(2-hydroxyethylsulfonyl)-2-methylphenyl]-1-(oxan-2-yl)methanesulfonamide |
|---|---|
| PubChem CID | 102563351 |
| Molecular Formula | C15H23NO6S2 |
| Molecular Weight | 377.48 g/mol |
| Exact Mass | 377.10 |
| IUPAC Name | N-[4-(2-hydroxyethylsulfonyl)-2-methylphenyl]-1-(oxan-2-yl)methanesulfonamide |
| SMILES | Cc1cc(S(=O)(=O)CCO)ccc1NS(=O)(=O)CC1CCCCO1 |
| InChI | InChI=1S/C15H23NO6S2/c1-12-10-14(23(18,19)9-7-17)5-6-15(12)16-24(20,21)11-13-4-2-3-8-22-13/h5-6,10,13,16-17H,2-4,7-9,11H2,1H3 |
| InChIKey | BCMQERCWCNLCSK-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 109.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.48 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |