C8H15NO5S — CID 78927442
(2R)-2-(oxolan-2-ylmethylsulfonylamino)propanoic acid (PubChem CID 78927442) has the molecular formula C8H15NO5S and a molecular weight of 237.28 g/mol. Its IUPAC name is (2R)-2-(oxolan-2-ylmethylsulfonylamino)propanoic acid.
| Compound Name | (2R)-2-(oxolan-2-ylmethylsulfonylamino)propanoic acid |
|---|---|
| PubChem CID | 78927442 |
| Molecular Formula | C8H15NO5S |
| Molecular Weight | 237.28 g/mol |
| Exact Mass | 237.07 |
| IUPAC Name | (2R)-2-(oxolan-2-ylmethylsulfonylamino)propanoic acid |
| SMILES | C[C@@H](NS(=O)(=O)CC1CCCO1)C(=O)O |
| InChI | InChI=1S/C8H15NO5S/c1-6(8(10)11)9-15(12,13)5-7-3-2-4-14-7/h6-7,9H,2-5H2,1H3,(H,10,11)/t6-,7?/m1/s1 |
| InChIKey | KVNJLGXBNURELN-ULUSZKPHSA-N |
| XLogP | -0.44 |
| TPSA | 92.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.28 |
| LogP ≤ 5 | -0.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |