C9H17NO6S — CID 81076359
3-methoxy-2-(oxolan-2-ylmethylsulfonylamino)propanoic acid (PubChem CID 81076359) has the molecular formula C9H17NO6S and a molecular weight of 267.30 g/mol. Its IUPAC name is 3-methoxy-2-(oxolan-2-ylmethylsulfonylamino)propanoic acid.
| Compound Name | 3-methoxy-2-(oxolan-2-ylmethylsulfonylamino)propanoic acid |
|---|---|
| PubChem CID | 81076359 |
| Molecular Formula | C9H17NO6S |
| Molecular Weight | 267.30 g/mol |
| Exact Mass | 267.08 |
| IUPAC Name | 3-methoxy-2-(oxolan-2-ylmethylsulfonylamino)propanoic acid |
| SMILES | COCC(NS(=O)(=O)CC1CCCO1)C(=O)O |
| InChI | InChI=1S/C9H17NO6S/c1-15-5-8(9(11)12)10-17(13,14)6-7-3-2-4-16-7/h7-8,10H,2-6H2,1H3,(H,11,12) |
| InChIKey | SAPSHDBEPDJKAD-UHFFFAOYSA-N |
| XLogP | -0.82 |
| TPSA | 101.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.30 |
| LogP ≤ 5 | -0.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |