C13H23NO5S — CID 146127666
3-cyclobutyl-2-(oxan-2-ylmethylsulfonylamino)propanoic acid (PubChem CID 146127666) has the molecular formula C13H23NO5S and a molecular weight of 305.40 g/mol. Its IUPAC name is 3-cyclobutyl-2-(oxan-2-ylmethylsulfonylamino)propanoic acid.
| Compound Name | 3-cyclobutyl-2-(oxan-2-ylmethylsulfonylamino)propanoic acid |
|---|---|
| PubChem CID | 146127666 |
| Molecular Formula | C13H23NO5S |
| Molecular Weight | 305.40 g/mol |
| Exact Mass | 305.13 |
| IUPAC Name | 3-cyclobutyl-2-(oxan-2-ylmethylsulfonylamino)propanoic acid |
| SMILES | O=C(O)C(CC1CCC1)NS(=O)(=O)CC1CCCCO1 |
| InChI | InChI=1S/C13H23NO5S/c15-13(16)12(8-10-4-3-5-10)14-20(17,18)9-11-6-1-2-7-19-11/h10-12,14H,1-9H2,(H,15,16) |
| InChIKey | XYPXMYUEPKNAER-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 92.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.40 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |