C13H13ClN2O3 — CID 166334911
oxolan-2-ylmethyl 5-chloro-1H-pyrrolo[2,3-c]pyridine-2-carboxylate (PubChem CID 166334911) has the molecular formula C13H13ClN2O3 and a molecular weight of 280.71 g/mol. Its IUPAC name is oxolan-2-ylmethyl 5-chloro-1H-pyrrolo[2,3-c]pyridine-2-carboxylate.
| Compound Name | oxolan-2-ylmethyl 5-chloro-1H-pyrrolo[2,3-c]pyridine-2-carboxylate |
|---|---|
| PubChem CID | 166334911 |
| Molecular Formula | C13H13ClN2O3 |
| Molecular Weight | 280.71 g/mol |
| Exact Mass | 280.06 |
| IUPAC Name | oxolan-2-ylmethyl 5-chloro-1H-pyrrolo[2,3-c]pyridine-2-carboxylate |
| SMILES | O=C(OCC1CCCO1)c1cc2cc(Cl)ncc2[nH]1 |
| InChI | InChI=1S/C13H13ClN2O3/c14-12-5-8-4-10(16-11(8)6-15-12)13(17)19-7-9-2-1-3-18-9/h4-6,9,16H,1-3,7H2 |
| InChIKey | JVIOCLMUHVQXNZ-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 64.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.71 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|