C12H12ClN3O3 — CID 87785070
ethyl 2-amino-3-(5-chloro-1H-pyrrolo[2,3-c]pyridin-2-yl)-3-oxopropanoate (PubChem CID 87785070) has the molecular formula C12H12ClN3O3 and a molecular weight of 281.70 g/mol. Its IUPAC name is ethyl 2-amino-3-(5-chloro-1H-pyrrolo[2,3-c]pyridin-2-yl)-3-oxopropanoate.
| Compound Name | ethyl 2-amino-3-(5-chloro-1H-pyrrolo[2,3-c]pyridin-2-yl)-3-oxopropanoate |
|---|---|
| PubChem CID | 87785070 |
| Molecular Formula | C12H12ClN3O3 |
| Molecular Weight | 281.70 g/mol |
| Exact Mass | 281.06 |
| IUPAC Name | ethyl 2-amino-3-(5-chloro-1H-pyrrolo[2,3-c]pyridin-2-yl)-3-oxopropanoate |
| SMILES | CCOC(=O)C(N)C(=O)c1cc2cc(Cl)ncc2[nH]1 |
| InChI | InChI=1S/C12H12ClN3O3/c1-2-19-12(18)10(14)11(17)7-3-6-4-9(13)15-5-8(6)16-7/h3-5,10,16H,2,14H2,1H3 |
| InChIKey | IKBYCHZYAVVQPU-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 98.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.70 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|