C19H17ClFN3O3 — CID 59753673
ethyl (2S)-2-[(5-chloro-1H-pyrrolo[2,3-c]pyridine-2-carbonyl)amino]-3-(4-fluorophenyl)propanoate (PubChem CID 59753673) has the molecular formula C19H17ClFN3O3 and a molecular weight of 389.81 g/mol. Its IUPAC name is ethyl (2S)-2-[(5-chloro-1H-pyrrolo[2,3-c]pyridine-2-carbonyl)amino]-3-(4-fluorophenyl)propanoate.
| Compound Name | ethyl (2S)-2-[(5-chloro-1H-pyrrolo[2,3-c]pyridine-2-carbonyl)amino]-3-(4-fluorophenyl)propanoate |
|---|---|
| PubChem CID | 59753673 |
| Molecular Formula | C19H17ClFN3O3 |
| Molecular Weight | 389.81 g/mol |
| Exact Mass | 389.09 |
| IUPAC Name | ethyl (2S)-2-[(5-chloro-1H-pyrrolo[2,3-c]pyridine-2-carbonyl)amino]-3-(4-fluorophenyl)propanoate |
| SMILES | CCOC(=O)[C@H](Cc1ccc(F)cc1)NC(=O)c1cc2cc(Cl)ncc2[nH]1 |
| InChI | InChI=1S/C19H17ClFN3O3/c1-2-27-19(26)15(7-11-3-5-13(21)6-4-11)24-18(25)14-8-12-9-17(20)22-10-16(12)23-14/h3-6,8-10,15,23H,2,7H2,1H3,(H,24,25)/t15-/m0/s1 |
| InChIKey | BFYGBVQESPWHEL-HNNXBMFYSA-N |
| XLogP | 3.26 |
| TPSA | 84.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.81 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|