C21H23ClFN5O2 — CID 142971284
5-chloro-N-[(2S)-1-[2-(ethylamino)ethylamino]-3-(4-fluorophenyl)-1-oxopropan-2-yl]-1H-pyrrolo[2,3-c]pyridine-2-carboxamide (PubChem CID 142971284) has the molecular formula C21H23ClFN5O2 and a molecular weight of 431.90 g/mol. Its IUPAC name is 5-chloro-N-[(2S)-1-[2-(ethylamino)ethylamino]-3-(4-fluorophenyl)-1-oxopropan-2-yl]-1H-pyrrolo[2,3-c]pyridine-2-carboxamide.
| Compound Name | 5-chloro-N-[(2S)-1-[2-(ethylamino)ethylamino]-3-(4-fluorophenyl)-1-oxopropan-2-yl]-1H-pyrrolo[2,3-c]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 142971284 |
| Molecular Formula | C21H23ClFN5O2 |
| Molecular Weight | 431.90 g/mol |
| Exact Mass | 431.15 |
| IUPAC Name | 5-chloro-N-[(2S)-1-[2-(ethylamino)ethylamino]-3-(4-fluorophenyl)-1-oxopropan-2-yl]-1H-pyrrolo[2,3-c]pyridine-2-carboxamide |
| SMILES | CCNCCNC(=O)[C@H](Cc1ccc(F)cc1)NC(=O)c1cc2cc(Cl)ncc2[nH]1 |
| InChI | InChI=1S/C21H23ClFN5O2/c1-2-24-7-8-25-20(29)16(9-13-3-5-15(23)6-4-13)28-21(30)17-10-14-11-19(22)26-12-18(14)27-17/h3-6,10-12,16,24,27H,2,7-9H2,1H3,(H,25,29)(H,28,30)/t16-/m0/s1 |
| InChIKey | KLDWNXJHKXJVNU-INIZCTEOSA-N |
| XLogP | 2.42 |
| TPSA | 98.91 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.90 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|