C19H20ClN3O3 — CID 142971269
5-chloro-1H-pyrrolo[2,3-c]pyridine-2-carboxamide;methyl 4-phenylbutanoate (PubChem CID 142971269) has the molecular formula C19H20ClN3O3 and a molecular weight of 373.84 g/mol. Its IUPAC name is 5-chloro-1H-pyrrolo[2,3-c]pyridine-2-carboxamide;methyl 4-phenylbutanoate.
| Compound Name | 5-chloro-1H-pyrrolo[2,3-c]pyridine-2-carboxamide;methyl 4-phenylbutanoate |
|---|---|
| PubChem CID | 142971269 |
| Molecular Formula | C19H20ClN3O3 |
| Molecular Weight | 373.84 g/mol |
| Exact Mass | 373.12 |
| IUPAC Name | 5-chloro-1H-pyrrolo[2,3-c]pyridine-2-carboxamide;methyl 4-phenylbutanoate |
| SMILES | COC(=O)CCCc1ccccc1.NC(=O)c1cc2cc(Cl)ncc2[nH]1 |
| InChI | InChI=1S/C11H14O2.C8H6ClN3O/c1-13-11(12)9-5-8-10-6-3-2-4-7-10;9-7-2-4-1-5(8(10)13)12-6(4)3-11-7/h2-4,6-7H,5,8-9H2,1H3;1-3,12H,(H2,10,13) |
| InChIKey | JNRYUYBTPQAGGE-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 98.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.84 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|