C19H18ClN3O4 — CID 87844066
methyl (2S)-2-[(5-chloro-1H-pyrrolo[2,3-c]pyridine-2-carbonyl)amino]-2-hydroxy-4-phenylbutanoate (PubChem CID 87844066) has the molecular formula C19H18ClN3O4 and a molecular weight of 387.82 g/mol. Its IUPAC name is methyl (2S)-2-[(5-chloro-1H-pyrrolo[2,3-c]pyridine-2-carbonyl)amino]-2-hydroxy-4-phenylbutanoate.
| Compound Name | methyl (2S)-2-[(5-chloro-1H-pyrrolo[2,3-c]pyridine-2-carbonyl)amino]-2-hydroxy-4-phenylbutanoate |
|---|---|
| PubChem CID | 87844066 |
| Molecular Formula | C19H18ClN3O4 |
| Molecular Weight | 387.82 g/mol |
| Exact Mass | 387.10 |
| IUPAC Name | methyl (2S)-2-[(5-chloro-1H-pyrrolo[2,3-c]pyridine-2-carbonyl)amino]-2-hydroxy-4-phenylbutanoate |
| SMILES | COC(=O)[C@@](O)(CCc1ccccc1)NC(=O)c1cc2cc(Cl)ncc2[nH]1 |
| InChI | InChI=1S/C19H18ClN3O4/c1-27-18(25)19(26,8-7-12-5-3-2-4-6-12)23-17(24)14-9-13-10-16(20)21-11-15(13)22-14/h2-6,9-11,22,26H,7-8H2,1H3,(H,23,24)/t19-/m0/s1 |
| InChIKey | XJADIDPAYVAHGQ-IBGZPJMESA-N |
| XLogP | 2.44 |
| TPSA | 104.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.82 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|