C19H18ClN3O3 — CID 22593878
N-(1-amino-2-hydroxy-1-oxo-4-phenylbutan-2-yl)-5-chloro-1H-indole-2-carboxamide (PubChem CID 22593878) has the molecular formula C19H18ClN3O3 and a molecular weight of 371.82 g/mol. Its IUPAC name is N-(1-amino-2-hydroxy-1-oxo-4-phenylbutan-2-yl)-5-chloro-1H-indole-2-carboxamide.
| Compound Name | N-(1-amino-2-hydroxy-1-oxo-4-phenylbutan-2-yl)-5-chloro-1H-indole-2-carboxamide |
|---|---|
| PubChem CID | 22593878 |
| Molecular Formula | C19H18ClN3O3 |
| Molecular Weight | 371.82 g/mol |
| Exact Mass | 371.10 |
| IUPAC Name | N-(1-amino-2-hydroxy-1-oxo-4-phenylbutan-2-yl)-5-chloro-1H-indole-2-carboxamide |
| SMILES | NC(=O)C(O)(CCc1ccccc1)NC(=O)c1cc2cc(Cl)ccc2[nH]1 |
| InChI | InChI=1S/C19H18ClN3O3/c20-14-6-7-15-13(10-14)11-16(22-15)17(24)23-19(26,18(21)25)9-8-12-4-2-1-3-5-12/h1-7,10-11,22,26H,8-9H2,(H2,21,25)(H,23,24) |
| InChIKey | JCTYMOUUCWDENN-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 108.21 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.82 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|