C23H24ClN3O5 — CID 57307891
5-chloro-N-[(2S)-4-(2,2-dihydroxypyrrolidin-1-yl)-2-hydroxy-4-oxo-1-phenylbutan-2-yl]-1H-indole-2-carboxamide (PubChem CID 57307891) has the molecular formula C23H24ClN3O5 and a molecular weight of 457.91 g/mol. Its IUPAC name is 5-chloro-N-[(2S)-4-(2,2-dihydroxypyrrolidin-1-yl)-2-hydroxy-4-oxo-1-phenylbutan-2-yl]-1H-indole-2-carboxamide.
| Compound Name | 5-chloro-N-[(2S)-4-(2,2-dihydroxypyrrolidin-1-yl)-2-hydroxy-4-oxo-1-phenylbutan-2-yl]-1H-indole-2-carboxamide |
|---|---|
| PubChem CID | 57307891 |
| Molecular Formula | C23H24ClN3O5 |
| Molecular Weight | 457.91 g/mol |
| Exact Mass | 457.14 |
| IUPAC Name | 5-chloro-N-[(2S)-4-(2,2-dihydroxypyrrolidin-1-yl)-2-hydroxy-4-oxo-1-phenylbutan-2-yl]-1H-indole-2-carboxamide |
| SMILES | O=C(N[C@@](O)(CC(=O)N1CCCC1(O)O)Cc1ccccc1)c1cc2cc(Cl)ccc2[nH]1 |
| InChI | InChI=1S/C23H24ClN3O5/c24-17-7-8-18-16(11-17)12-19(25-18)21(29)26-22(30,13-15-5-2-1-3-6-15)14-20(28)27-10-4-9-23(27,31)32/h1-3,5-8,11-12,25,30-32H,4,9-10,13-14H2,(H,26,29)/t22-/m0/s1 |
| InChIKey | DRLLSQICPMMNFM-QFIPXVFZSA-N |
| XLogP | 2.13 |
| TPSA | 125.89 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.91 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|