C14H12ClN3O3S — CID 57187690
5-chloro-N-[2-oxo-2-(2-oxo-1,3-thiazolidin-3-yl)ethyl]-1H-indole-2-carboxamide (PubChem CID 57187690) has the molecular formula C14H12ClN3O3S and a molecular weight of 337.79 g/mol. Its IUPAC name is 5-chloro-N-[2-oxo-2-(2-oxo-1,3-thiazolidin-3-yl)ethyl]-1H-indole-2-carboxamide.
| Compound Name | 5-chloro-N-[2-oxo-2-(2-oxo-1,3-thiazolidin-3-yl)ethyl]-1H-indole-2-carboxamide |
|---|---|
| PubChem CID | 57187690 |
| Molecular Formula | C14H12ClN3O3S |
| Molecular Weight | 337.79 g/mol |
| Exact Mass | 337.03 |
| IUPAC Name | 5-chloro-N-[2-oxo-2-(2-oxo-1,3-thiazolidin-3-yl)ethyl]-1H-indole-2-carboxamide |
| SMILES | O=C(NCC(=O)N1CCSC1=O)c1cc2cc(Cl)ccc2[nH]1 |
| InChI | InChI=1S/C14H12ClN3O3S/c15-9-1-2-10-8(5-9)6-11(17-10)13(20)16-7-12(19)18-3-4-22-14(18)21/h1-2,5-6,17H,3-4,7H2,(H,16,20) |
| InChIKey | RYVSLBWPTNOTGV-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 82.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.79 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|