C20H29ClN2O — CID 144935836
5-chloro-N-[(E)-2-methylpent-2-enyl]-1H-indole-2-carboxamide;2-methylbutane (PubChem CID 144935836) has the molecular formula C20H29ClN2O and a molecular weight of 348.92 g/mol. Its IUPAC name is 5-chloro-N-[(E)-2-methylpent-2-enyl]-1H-indole-2-carboxamide;2-methylbutane.
| Compound Name | 5-chloro-N-[(E)-2-methylpent-2-enyl]-1H-indole-2-carboxamide;2-methylbutane |
|---|---|
| PubChem CID | 144935836 |
| Molecular Formula | C20H29ClN2O |
| Molecular Weight | 348.92 g/mol |
| Exact Mass | 348.20 |
| IUPAC Name | 5-chloro-N-[(E)-2-methylpent-2-enyl]-1H-indole-2-carboxamide;2-methylbutane |
| SMILES | CC/C=C(\C)CNC(=O)c1cc2cc(Cl)ccc2[nH]1.CCC(C)C |
| InChI | InChI=1S/C15H17ClN2O.C5H12/c1-3-4-10(2)9-17-15(19)14-8-11-7-12(16)5-6-13(11)18-14;1-4-5(2)3/h4-8,18H,3,9H2,1-2H3,(H,17,19);5H,4H2,1-3H3/b10-4+; |
| InChIKey | NCQHPSBJTMCSGR-FCVRUTMISA-N |
| XLogP | 5.96 |
| TPSA | 44.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.92 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|