C19H18ClN3O3S — CID 51114529
5-chloro-N-[2-(2,3-dihydroindol-1-ylsulfonyl)ethyl]-1H-indole-2-carboxamide (PubChem CID 51114529) has the molecular formula C19H18ClN3O3S and a molecular weight of 403.89 g/mol. Its IUPAC name is 5-chloro-N-[2-(2,3-dihydroindol-1-ylsulfonyl)ethyl]-1H-indole-2-carboxamide.
| Compound Name | 5-chloro-N-[2-(2,3-dihydroindol-1-ylsulfonyl)ethyl]-1H-indole-2-carboxamide |
|---|---|
| PubChem CID | 51114529 |
| Molecular Formula | C19H18ClN3O3S |
| Molecular Weight | 403.89 g/mol |
| Exact Mass | 403.08 |
| IUPAC Name | 5-chloro-N-[2-(2,3-dihydroindol-1-ylsulfonyl)ethyl]-1H-indole-2-carboxamide |
| SMILES | O=C(NCCS(=O)(=O)N1CCc2ccccc21)c1cc2cc(Cl)ccc2[nH]1 |
| InChI | InChI=1S/C19H18ClN3O3S/c20-15-5-6-16-14(11-15)12-17(22-16)19(24)21-8-10-27(25,26)23-9-7-13-3-1-2-4-18(13)23/h1-6,11-12,22H,7-10H2,(H,21,24) |
| InChIKey | JHABABOAXYPFEE-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 82.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.89 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |