C22H22BrN3O4 — CID 55900021
3-(5-bromo-1,3-dioxoisoindol-2-yl)-N-(oxolan-2-ylmethyl)-N-(pyridin-3-ylmethyl)propanamide (PubChem CID 55900021) has the molecular formula C22H22BrN3O4 and a molecular weight of 472.34 g/mol. Its IUPAC name is 3-(5-bromo-1,3-dioxoisoindol-2-yl)-N-(oxolan-2-ylmethyl)-N-(pyridin-3-ylmethyl)propanamide.
| Compound Name | 3-(5-bromo-1,3-dioxoisoindol-2-yl)-N-(oxolan-2-ylmethyl)-N-(pyridin-3-ylmethyl)propanamide |
|---|---|
| PubChem CID | 55900021 |
| Molecular Formula | C22H22BrN3O4 |
| Molecular Weight | 472.34 g/mol |
| Exact Mass | 471.08 |
| IUPAC Name | 3-(5-bromo-1,3-dioxoisoindol-2-yl)-N-(oxolan-2-ylmethyl)-N-(pyridin-3-ylmethyl)propanamide |
| SMILES | O=C(CCN1C(=O)c2ccc(Br)cc2C1=O)N(Cc1cccnc1)CC1CCCO1 |
| InChI | InChI=1S/C22H22BrN3O4/c23-16-5-6-18-19(11-16)22(29)26(21(18)28)9-7-20(27)25(14-17-4-2-10-30-17)13-15-3-1-8-24-12-15/h1,3,5-6,8,11-12,17H,2,4,7,9-10,13-14H2 |
| InChIKey | MFMDOJMKQIDNRE-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 79.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.34 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|