C23H23BrN4O3 — CID 55779716
3-(5-bromo-1,3-dioxoisoindol-2-yl)-N-[(4-cyanophenyl)methyl]-N-[2-(dimethylamino)ethyl]propanamide (PubChem CID 55779716) has the molecular formula C23H23BrN4O3 and a molecular weight of 483.37 g/mol. Its IUPAC name is 3-(5-bromo-1,3-dioxoisoindol-2-yl)-N-[(4-cyanophenyl)methyl]-N-[2-(dimethylamino)ethyl]propanamide.
| Compound Name | 3-(5-bromo-1,3-dioxoisoindol-2-yl)-N-[(4-cyanophenyl)methyl]-N-[2-(dimethylamino)ethyl]propanamide |
|---|---|
| PubChem CID | 55779716 |
| Molecular Formula | C23H23BrN4O3 |
| Molecular Weight | 483.37 g/mol |
| Exact Mass | 482.10 |
| IUPAC Name | 3-(5-bromo-1,3-dioxoisoindol-2-yl)-N-[(4-cyanophenyl)methyl]-N-[2-(dimethylamino)ethyl]propanamide |
| SMILES | CN(C)CCN(Cc1ccc(C#N)cc1)C(=O)CCN1C(=O)c2ccc(Br)cc2C1=O |
| InChI | InChI=1S/C23H23BrN4O3/c1-26(2)11-12-27(15-17-5-3-16(14-25)4-6-17)21(29)9-10-28-22(30)19-8-7-18(24)13-20(19)23(28)31/h3-8,13H,9-12,15H2,1-2H3 |
| InChIKey | XZRCSPVRMAKDJT-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 84.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.37 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|