C24H23BrN4O3 — CID 55461451
4-[[4-[3-(5-bromo-1,3-dioxoisoindol-2-yl)propanoyl]-1,4-diazepan-1-yl]methyl]benzonitrile (PubChem CID 55461451) has the molecular formula C24H23BrN4O3 and a molecular weight of 495.38 g/mol. Its IUPAC name is 4-[[4-[3-(5-bromo-1,3-dioxoisoindol-2-yl)propanoyl]-1,4-diazepan-1-yl]methyl]benzonitrile.
| Compound Name | 4-[[4-[3-(5-bromo-1,3-dioxoisoindol-2-yl)propanoyl]-1,4-diazepan-1-yl]methyl]benzonitrile |
|---|---|
| PubChem CID | 55461451 |
| Molecular Formula | C24H23BrN4O3 |
| Molecular Weight | 495.38 g/mol |
| Exact Mass | 494.10 |
| IUPAC Name | 4-[[4-[3-(5-bromo-1,3-dioxoisoindol-2-yl)propanoyl]-1,4-diazepan-1-yl]methyl]benzonitrile |
| SMILES | N#Cc1ccc(CN2CCCN(C(=O)CCN3C(=O)c4ccc(Br)cc4C3=O)CC2)cc1 |
| InChI | InChI=1S/C24H23BrN4O3/c25-19-6-7-20-21(14-19)24(32)29(23(20)31)11-8-22(30)28-10-1-9-27(12-13-28)16-18-4-2-17(15-26)3-5-18/h2-7,14H,1,8-13,16H2 |
| InChIKey | HXBNFTTWLGHXOT-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 84.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.38 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|