C19H22N4O3 — CID 18111020
4-[[4-[3-(2,5-dioxopyrrolidin-1-yl)propanoyl]piperazin-1-yl]methyl]benzonitrile (PubChem CID 18111020) has the molecular formula C19H22N4O3 and a molecular weight of 354.41 g/mol. Its IUPAC name is 4-[[4-[3-(2,5-dioxopyrrolidin-1-yl)propanoyl]piperazin-1-yl]methyl]benzonitrile.
| Compound Name | 4-[[4-[3-(2,5-dioxopyrrolidin-1-yl)propanoyl]piperazin-1-yl]methyl]benzonitrile |
|---|---|
| PubChem CID | 18111020 |
| Molecular Formula | C19H22N4O3 |
| Molecular Weight | 354.41 g/mol |
| Exact Mass | 354.17 |
| IUPAC Name | 4-[[4-[3-(2,5-dioxopyrrolidin-1-yl)propanoyl]piperazin-1-yl]methyl]benzonitrile |
| SMILES | N#Cc1ccc(CN2CCN(C(=O)CCN3C(=O)CCC3=O)CC2)cc1 |
| InChI | InChI=1S/C19H22N4O3/c20-13-15-1-3-16(4-2-15)14-21-9-11-22(12-10-21)17(24)7-8-23-18(25)5-6-19(23)26/h1-4H,5-12,14H2 |
| InChIKey | JCTAIVGOMGWGIJ-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 84.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.41 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|