C23H30BrN3O3 — CID 55955198
5-bromo-2-[3-[4-(cyclohexylmethyl)-1,4-diazepan-1-yl]-3-oxopropyl]isoindole-1,3-dione (PubChem CID 55955198) has the molecular formula C23H30BrN3O3 and a molecular weight of 476.42 g/mol. Its IUPAC name is 5-bromo-2-[3-[4-(cyclohexylmethyl)-1,4-diazepan-1-yl]-3-oxopropyl]isoindole-1,3-dione.
| Compound Name | 5-bromo-2-[3-[4-(cyclohexylmethyl)-1,4-diazepan-1-yl]-3-oxopropyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 55955198 |
| Molecular Formula | C23H30BrN3O3 |
| Molecular Weight | 476.42 g/mol |
| Exact Mass | 475.15 |
| IUPAC Name | 5-bromo-2-[3-[4-(cyclohexylmethyl)-1,4-diazepan-1-yl]-3-oxopropyl]isoindole-1,3-dione |
| SMILES | O=C(CCN1C(=O)c2ccc(Br)cc2C1=O)N1CCCN(CC2CCCCC2)CC1 |
| InChI | InChI=1S/C23H30BrN3O3/c24-18-7-8-19-20(15-18)23(30)27(22(19)29)12-9-21(28)26-11-4-10-25(13-14-26)16-17-5-2-1-3-6-17/h7-8,15,17H,1-6,9-14,16H2 |
| InChIKey | RDDALNLIUAWDHV-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 60.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.42 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|