C14H13F4N3O3 — CID 70708571
3-(2,5-dioxoimidazolidin-4-yl)-N-[[5-fluoro-2-(trifluoromethyl)phenyl]methyl]propanamide (PubChem CID 70708571) has the molecular formula C14H13F4N3O3 and a molecular weight of 347.27 g/mol. Its IUPAC name is 3-(2,5-dioxoimidazolidin-4-yl)-N-[[5-fluoro-2-(trifluoromethyl)phenyl]methyl]propanamide.
| Compound Name | 3-(2,5-dioxoimidazolidin-4-yl)-N-[[5-fluoro-2-(trifluoromethyl)phenyl]methyl]propanamide |
|---|---|
| PubChem CID | 70708571 |
| Molecular Formula | C14H13F4N3O3 |
| Molecular Weight | 347.27 g/mol |
| Exact Mass | 347.09 |
| IUPAC Name | 3-(2,5-dioxoimidazolidin-4-yl)-N-[[5-fluoro-2-(trifluoromethyl)phenyl]methyl]propanamide |
| SMILES | O=C(CCC1NC(=O)NC1=O)NCc1cc(F)ccc1C(F)(F)F |
| InChI | InChI=1S/C14H13F4N3O3/c15-8-1-2-9(14(16,17)18)7(5-8)6-19-11(22)4-3-10-12(23)21-13(24)20-10/h1-2,5,10H,3-4,6H2,(H,19,22)(H2,20,21,23,24) |
| InChIKey | SDBUPZHXOFMNTP-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.27 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|