C17H22N4O3 — CID 70730130
3-(2,5-dioxoimidazolidin-4-yl)-N-[(3-pyrrolidin-1-ylphenyl)methyl]propanamide (PubChem CID 70730130) has the molecular formula C17H22N4O3 and a molecular weight of 330.39 g/mol. Its IUPAC name is 3-(2,5-dioxoimidazolidin-4-yl)-N-[(3-pyrrolidin-1-ylphenyl)methyl]propanamide.
| Compound Name | 3-(2,5-dioxoimidazolidin-4-yl)-N-[(3-pyrrolidin-1-ylphenyl)methyl]propanamide |
|---|---|
| PubChem CID | 70730130 |
| Molecular Formula | C17H22N4O3 |
| Molecular Weight | 330.39 g/mol |
| Exact Mass | 330.17 |
| IUPAC Name | 3-(2,5-dioxoimidazolidin-4-yl)-N-[(3-pyrrolidin-1-ylphenyl)methyl]propanamide |
| SMILES | O=C(CCC1NC(=O)NC1=O)NCc1cccc(N2CCCC2)c1 |
| InChI | InChI=1S/C17H22N4O3/c22-15(7-6-14-16(23)20-17(24)19-14)18-11-12-4-3-5-13(10-12)21-8-1-2-9-21/h3-5,10,14H,1-2,6-9,11H2,(H,18,22)(H2,19,20,23,24) |
| InChIKey | JXVPDNBNEPEZDF-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 90.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.39 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|