C22H21N3O6 — CID 99870911
N-(3-acetylphenyl)-3-[(4R)-1-(1,3-benzodioxol-5-ylmethyl)-2,5-dioxoimidazolidin-4-yl]propanamide (PubChem CID 99870911) has the molecular formula C22H21N3O6 and a molecular weight of 423.43 g/mol. Its IUPAC name is N-(3-acetylphenyl)-3-[(4R)-1-(1,3-benzodioxol-5-ylmethyl)-2,5-dioxoimidazolidin-4-yl]propanamide.
| Compound Name | N-(3-acetylphenyl)-3-[(4R)-1-(1,3-benzodioxol-5-ylmethyl)-2,5-dioxoimidazolidin-4-yl]propanamide |
|---|---|
| PubChem CID | 99870911 |
| Molecular Formula | C22H21N3O6 |
| Molecular Weight | 423.43 g/mol |
| Exact Mass | 423.14 |
| IUPAC Name | N-(3-acetylphenyl)-3-[(4R)-1-(1,3-benzodioxol-5-ylmethyl)-2,5-dioxoimidazolidin-4-yl]propanamide |
| SMILES | CC(=O)c1cccc(NC(=O)CC[C@H]2NC(=O)N(Cc3ccc4c(c3)OCO4)C2=O)c1 |
| InChI | InChI=1S/C22H21N3O6/c1-13(26)15-3-2-4-16(10-15)23-20(27)8-6-17-21(28)25(22(29)24-17)11-14-5-7-18-19(9-14)31-12-30-18/h2-5,7,9-10,17H,6,8,11-12H2,1H3,(H,23,27)(H,24,29)/t17-/m1/s1 |
| InChIKey | DAOKPPQYDLGGGA-QGZVFWFLSA-N |
| XLogP | 2.46 |
| TPSA | 114.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.43 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|