C26H19BF6N2O4S — CID 85307010
2-[3,5-bis(trifluoromethyl)phenyl]-4-(1H-indol-3-ylmethyl)-3-(4-methylphenyl)sulfonyl-1,3,2-oxazaborolidin-5-one (PubChem CID 85307010) has the molecular formula C26H19BF6N2O4S and a molecular weight of 580.32 g/mol. Its IUPAC name is 2-[3,5-bis(trifluoromethyl)phenyl]-4-(1H-indol-3-ylmethyl)-3-(4-methylphenyl)sulfonyl-1,3,2-oxazaborolidin-5-one.
| Compound Name | 2-[3,5-bis(trifluoromethyl)phenyl]-4-(1H-indol-3-ylmethyl)-3-(4-methylphenyl)sulfonyl-1,3,2-oxazaborolidin-5-one |
|---|---|
| PubChem CID | 85307010 |
| Molecular Formula | C26H19BF6N2O4S |
| Molecular Weight | 580.32 g/mol |
| Exact Mass | 580.11 |
| IUPAC Name | 2-[3,5-bis(trifluoromethyl)phenyl]-4-(1H-indol-3-ylmethyl)-3-(4-methylphenyl)sulfonyl-1,3,2-oxazaborolidin-5-one |
| SMILES | Cc1ccc(S(=O)(=O)N2B(c3cc(C(F)(F)F)cc(C(F)(F)F)c3)OC(=O)C2Cc2c[nH]c3ccccc23)cc1 |
| InChI | InChI=1S/C26H19BF6N2O4S/c1-15-6-8-20(9-7-15)40(37,38)35-23(10-16-14-34-22-5-3-2-4-21(16)22)24(36)39-27(35)19-12-17(25(28,29)30)11-18(13-19)26(31,32)33/h2-9,11-14,23,34H,10H2,1H3 |
| InChIKey | MZICLIBFCIBCNZ-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 79.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.32 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|