C23H27BN2O4S — CID 11080642
(4S)-2-butyl-4-[(1R)-1-(1H-indol-3-yl)ethyl]-3-(4-methylphenyl)sulfonyl-1,3,2-oxazaborolidin-5-one (PubChem CID 11080642) has the molecular formula C23H27BN2O4S and a molecular weight of 438.36 g/mol. Its IUPAC name is (4S)-2-butyl-4-[(1R)-1-(1H-indol-3-yl)ethyl]-3-(4-methylphenyl)sulfonyl-1,3,2-oxazaborolidin-5-one.
| Compound Name | (4S)-2-butyl-4-[(1R)-1-(1H-indol-3-yl)ethyl]-3-(4-methylphenyl)sulfonyl-1,3,2-oxazaborolidin-5-one |
|---|---|
| PubChem CID | 11080642 |
| Molecular Formula | C23H27BN2O4S |
| Molecular Weight | 438.36 g/mol |
| Exact Mass | 438.18 |
| IUPAC Name | (4S)-2-butyl-4-[(1R)-1-(1H-indol-3-yl)ethyl]-3-(4-methylphenyl)sulfonyl-1,3,2-oxazaborolidin-5-one |
| SMILES | CCCCB1OC(=O)[C@H]([C@H](C)c2c[nH]c3ccccc23)N1S(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C23H27BN2O4S/c1-4-5-14-24-26(31(28,29)18-12-10-16(2)11-13-18)22(23(27)30-24)17(3)20-15-25-21-9-7-6-8-19(20)21/h6-13,15,17,22,25H,4-5,14H2,1-3H3/t17-,22+/m1/s1 |
| InChIKey | AEZQINAUIKNMDL-VGSWGCGISA-N |
| XLogP | 4.48 |
| TPSA | 79.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.36 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|