C24H23NO3S — CID 162689482
3-[(2-ethoxyphenyl)-(4-methylphenyl)sulfonylmethyl]-1H-indole (PubChem CID 162689482) has the molecular formula C24H23NO3S and a molecular weight of 405.52 g/mol. Its IUPAC name is 3-[(2-ethoxyphenyl)-(4-methylphenyl)sulfonylmethyl]-1H-indole.
| Compound Name | 3-[(2-ethoxyphenyl)-(4-methylphenyl)sulfonylmethyl]-1H-indole |
|---|---|
| PubChem CID | 162689482 |
| Molecular Formula | C24H23NO3S |
| Molecular Weight | 405.52 g/mol |
| Exact Mass | 405.14 |
| IUPAC Name | 3-[(2-ethoxyphenyl)-(4-methylphenyl)sulfonylmethyl]-1H-indole |
| SMILES | CCOc1ccccc1C(c1c[nH]c2ccccc12)S(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C24H23NO3S/c1-3-28-23-11-7-5-9-20(23)24(21-16-25-22-10-6-4-8-19(21)22)29(26,27)18-14-12-17(2)13-15-18/h4-16,24-25H,3H2,1-2H3 |
| InChIKey | IUBJFTBNIKINQH-UHFFFAOYSA-N |
| XLogP | 5.44 |
| TPSA | 59.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.52 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |