About 3-[(2,4-difluorophenyl)-(4-methylphenyl)sulfonylmethyl]-1H-pyrrolo[2,3-b]pyridine
3-[(2,4-difluorophenyl)-(4-methylphenyl)sulfonylmethyl]-1H-pyrrolo[2,3-b]pyridine (PubChem CID 162689471) has the molecular formula C21H16F2N2O2S
and a molecular weight of 398.43 g/mol. Its IUPAC name is 3-[(2,4-difluorophenyl)-(4-methylphenyl)sulfonylmethyl]-1H-pyrrolo[2,3-b]pyridine.
Molecular Properties
| Compound Name | 3-[(2,4-difluorophenyl)-(4-methylphenyl)sulfonylmethyl]-1H-pyrrolo[2,3-b]pyridine |
| PubChem CID | 162689471 |
| Molecular Formula | C21H16F2N2O2S |
| Molecular Weight | 398.43 g/mol |
| Exact Mass | 398.09 |
| IUPAC Name | 3-[(2,4-difluorophenyl)-(4-methylphenyl)sulfonylmethyl]-1H-pyrrolo[2,3-b]pyridine |
| SMILES | Cc1ccc(S(=O)(=O)C(c2ccc(F)cc2F)c2c[nH]c3ncccc23)cc1 |
| InChI | InChI=1S/C21H16F2N2O2S/c1-13-4-7-15(8-5-13)28(26,27)20(17-9-6-14(22)11-19(17)23)18-12-25-21-16(18)3-2-10-24-21/h2-12,20H,1H3,(H,24,25) |
| InChIKey | IGAUSRYENYUQTH-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 62.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 398.43 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-[(2,4-difluorophenyl)-(4-methylphenyl)sulfonylmethyl]-1H-pyrrolo[2,3-b]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(2,4-difluorophenyl)-(4-methylphenyl)sulfonylmethyl]-1H-pyrrolo[2,3-b]pyridine?
The IUPAC name of 3-[(2,4-difluorophenyl)-(4-methylphenyl)sulfonylmethyl]-1H-pyrrolo[2,3-b]pyridine (CID 162689471) is 3-[(2,4-difluorophenyl)-(4-methylphenyl)sulfonylmethyl]-1H-pyrrolo[2,3-b]pyridine.
What is the SMILES notation for 3-[(2,4-difluorophenyl)-(4-methylphenyl)sulfonylmethyl]-1H-pyrrolo[2,3-b]pyridine?
The canonical SMILES for 3-[(2,4-difluorophenyl)-(4-methylphenyl)sulfonylmethyl]-1H-pyrrolo[2,3-b]pyridine is Cc1ccc(S(=O)(=O)C(c2ccc(F)cc2F)c2c[nH]c3ncccc23)cc1.
What is the InChIKey of 3-[(2,4-difluorophenyl)-(4-methylphenyl)sulfonylmethyl]-1H-pyrrolo[2,3-b]pyridine?
The InChIKey is IGAUSRYENYUQTH-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H16F2N2O2S/c1-13-4-7-15(8-5-13)28(26,27)20(17-9-6-14(22)11-19(17)23)18-12-25-21-16(18)3-2-10-24-21/h2-12,20H,1H3,(H,24,25).
What are the key properties of 3-[(2,4-difluorophenyl)-(4-methylphenyl)sulfonylmethyl]-1H-pyrrolo[2,3-b]pyridine?
3-[(2,4-difluorophenyl)-(4-methylphenyl)sulfonylmethyl]-1H-pyrrolo[2,3-b]pyridine has a molecular weight of 398.43 g/mol, XLogP of 4.71, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(2,4-difluorophenyl)-(4-methylphenyl)sulfonylmethyl]-1H-pyrrolo[2,3-b]pyridine is sourced from PubChem (CID 162689471), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).