C24H26F2N2O4S — CID 142980725
2-[2-[[4-[(2,5-difluorophenyl)-(4-methylphenyl)sulfonylmethyl]-5-methyl-2-pyridinyl]amino]ethoxy]ethanol (PubChem CID 142980725) has the molecular formula C24H26F2N2O4S and a molecular weight of 476.55 g/mol. Its IUPAC name is 2-[2-[[4-[(2,5-difluorophenyl)-(4-methylphenyl)sulfonylmethyl]-5-methyl-2-pyridinyl]amino]ethoxy]ethanol.
| Compound Name | 2-[2-[[4-[(2,5-difluorophenyl)-(4-methylphenyl)sulfonylmethyl]-5-methyl-2-pyridinyl]amino]ethoxy]ethanol |
|---|---|
| PubChem CID | 142980725 |
| Molecular Formula | C24H26F2N2O4S |
| Molecular Weight | 476.55 g/mol |
| Exact Mass | 476.16 |
| IUPAC Name | 2-[2-[[4-[(2,5-difluorophenyl)-(4-methylphenyl)sulfonylmethyl]-5-methyl-2-pyridinyl]amino]ethoxy]ethanol |
| SMILES | Cc1ccc(S(=O)(=O)C(c2cc(NCCOCCO)ncc2C)c2cc(F)ccc2F)cc1 |
| InChI | InChI=1S/C24H26F2N2O4S/c1-16-3-6-19(7-4-16)33(30,31)24(21-13-18(25)5-8-22(21)26)20-14-23(28-15-17(20)2)27-9-11-32-12-10-29/h3-8,13-15,24,29H,9-12H2,1-2H3,(H,27,28) |
| InChIKey | DFGQCDZVPNQKLQ-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 88.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.55 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|