C22H21Cl2F2N3O2S2 — CID 142980689
5-chloro-4-[(4-chlorophenyl)sulfonyl-(2,5-difluorophenyl)methyl]-N-[2-(dimethylamino)ethylsulfanyl]pyridin-2-amine (PubChem CID 142980689) has the molecular formula C22H21Cl2F2N3O2S2 and a molecular weight of 532.47 g/mol. Its IUPAC name is 5-chloro-4-[(4-chlorophenyl)sulfonyl-(2,5-difluorophenyl)methyl]-N-[2-(dimethylamino)ethylsulfanyl]pyridin-2-amine.
| Compound Name | 5-chloro-4-[(4-chlorophenyl)sulfonyl-(2,5-difluorophenyl)methyl]-N-[2-(dimethylamino)ethylsulfanyl]pyridin-2-amine |
|---|---|
| PubChem CID | 142980689 |
| Molecular Formula | C22H21Cl2F2N3O2S2 |
| Molecular Weight | 532.47 g/mol |
| Exact Mass | 531.04 |
| IUPAC Name | 5-chloro-4-[(4-chlorophenyl)sulfonyl-(2,5-difluorophenyl)methyl]-N-[2-(dimethylamino)ethylsulfanyl]pyridin-2-amine |
| SMILES | CN(C)CCSNc1cc(C(c2cc(F)ccc2F)S(=O)(=O)c2ccc(Cl)cc2)c(Cl)cn1 |
| InChI | InChI=1S/C22H21Cl2F2N3O2S2/c1-29(2)9-10-32-28-21-12-17(19(24)13-27-21)22(18-11-15(25)5-8-20(18)26)33(30,31)16-6-3-14(23)4-7-16/h3-8,11-13,22H,9-10H2,1-2H3,(H,27,28) |
| InChIKey | YVGGFJLSIXYCPQ-UHFFFAOYSA-N |
| XLogP | 5.85 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.47 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|