C20H15ClF2N2O3S2 — CID 174500756
6-[(4-chlorophenyl)sulfonyl-(2,5-difluorophenyl)methyl]-N-methylsulfanylpyridine-3-carboxamide (PubChem CID 174500756) has the molecular formula C20H15ClF2N2O3S2 and a molecular weight of 468.93 g/mol. Its IUPAC name is 6-[(4-chlorophenyl)sulfonyl-(2,5-difluorophenyl)methyl]-N-methylsulfanylpyridine-3-carboxamide.
| Compound Name | 6-[(4-chlorophenyl)sulfonyl-(2,5-difluorophenyl)methyl]-N-methylsulfanylpyridine-3-carboxamide |
|---|---|
| PubChem CID | 174500756 |
| Molecular Formula | C20H15ClF2N2O3S2 |
| Molecular Weight | 468.93 g/mol |
| Exact Mass | 468.02 |
| IUPAC Name | 6-[(4-chlorophenyl)sulfonyl-(2,5-difluorophenyl)methyl]-N-methylsulfanylpyridine-3-carboxamide |
| SMILES | CSNC(=O)c1ccc(C(c2cc(F)ccc2F)S(=O)(=O)c2ccc(Cl)cc2)nc1 |
| InChI | InChI=1S/C20H15ClF2N2O3S2/c1-29-25-20(26)12-2-9-18(24-11-12)19(16-10-14(22)5-8-17(16)23)30(27,28)15-6-3-13(21)4-7-15/h2-11,19H,1H3,(H,25,26) |
| InChIKey | LOMBAVTVKGGUMM-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 76.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.93 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|