C22H17ClF2N3O4S2- — CID 23114568
N-[2-[[6-[(4-chlorophenyl)sulfonyl-(2,5-difluorophenyl)methyl]pyridine-3-carbothioyl]amino]ethyl]carbamate (PubChem CID 23114568) has the molecular formula C22H17ClF2N3O4S2- and a molecular weight of 524.98 g/mol. Its IUPAC name is N-[2-[[6-[(4-chlorophenyl)sulfonyl-(2,5-difluorophenyl)methyl]pyridine-3-carbothioyl]amino]ethyl]carbamate.
| Compound Name | N-[2-[[6-[(4-chlorophenyl)sulfonyl-(2,5-difluorophenyl)methyl]pyridine-3-carbothioyl]amino]ethyl]carbamate |
|---|---|
| PubChem CID | 23114568 |
| Molecular Formula | C22H17ClF2N3O4S2- |
| Molecular Weight | 524.98 g/mol |
| Exact Mass | 524.03 |
| IUPAC Name | N-[2-[[6-[(4-chlorophenyl)sulfonyl-(2,5-difluorophenyl)methyl]pyridine-3-carbothioyl]amino]ethyl]carbamate |
| SMILES | O=C([O-])NCCNC(=S)c1ccc(C(c2cc(F)ccc2F)S(=O)(=O)c2ccc(Cl)cc2)nc1 |
| InChI | InChI=1S/C22H18ClF2N3O4S2/c23-14-2-5-16(6-3-14)34(31,32)20(17-11-15(24)4-7-18(17)25)19-8-1-13(12-28-19)21(33)26-9-10-27-22(29)30/h1-8,11-12,20,27H,9-10H2,(H,26,33)(H,29,30)/p-1 |
| InChIKey | RKTMKYRPZKWPQL-UHFFFAOYSA-M |
| XLogP | 2.77 |
| TPSA | 111.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.98 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|