C20H17ClF2N2OS — CID 142260407
[6-[[(4-chlorophenyl)-methylidene-oxo-λ6-sulfanyl]-(2,5-difluorophenyl)methyl]-3-pyridinyl]methanamine (PubChem CID 142260407) has the molecular formula C20H17ClF2N2OS and a molecular weight of 406.89 g/mol. Its IUPAC name is [6-[[(4-chlorophenyl)-methylidene-oxo-λ6-sulfanyl]-(2,5-difluorophenyl)methyl]-3-pyridinyl]methanamine.
| Compound Name | [6-[[(4-chlorophenyl)-methylidene-oxo-λ6-sulfanyl]-(2,5-difluorophenyl)methyl]-3-pyridinyl]methanamine |
|---|---|
| PubChem CID | 142260407 |
| Molecular Formula | C20H17ClF2N2OS |
| Molecular Weight | 406.89 g/mol |
| Exact Mass | 406.07 |
| IUPAC Name | [6-[[(4-chlorophenyl)-methylidene-oxo-λ6-sulfanyl]-(2,5-difluorophenyl)methyl]-3-pyridinyl]methanamine |
| SMILES | C=S(=O)(c1ccc(Cl)cc1)C(c1ccc(CN)cn1)c1cc(F)ccc1F |
| InChI | InChI=1S/C20H17ClF2N2OS/c1-27(26,16-6-3-14(21)4-7-16)20(17-10-15(22)5-8-18(17)23)19-9-2-13(11-24)12-25-19/h2-10,12,20H,1,11,24H2 |
| InChIKey | WLYVORZRKDBMIU-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 55.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.89 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|