C19H14ClF2NO2S — CID 142980749
2-[(4-chlorophenyl)methylsulfonyl-(2,5-difluorophenyl)methyl]pyridine (PubChem CID 142980749) has the molecular formula C19H14ClF2NO2S and a molecular weight of 393.84 g/mol. Its IUPAC name is 2-[(4-chlorophenyl)methylsulfonyl-(2,5-difluorophenyl)methyl]pyridine.
| Compound Name | 2-[(4-chlorophenyl)methylsulfonyl-(2,5-difluorophenyl)methyl]pyridine |
|---|---|
| PubChem CID | 142980749 |
| Molecular Formula | C19H14ClF2NO2S |
| Molecular Weight | 393.84 g/mol |
| Exact Mass | 393.04 |
| IUPAC Name | 2-[(4-chlorophenyl)methylsulfonyl-(2,5-difluorophenyl)methyl]pyridine |
| SMILES | O=S(=O)(Cc1ccc(Cl)cc1)C(c1ccccn1)c1cc(F)ccc1F |
| InChI | InChI=1S/C19H14ClF2NO2S/c20-14-6-4-13(5-7-14)12-26(24,25)19(18-3-1-2-10-23-18)16-11-15(21)8-9-17(16)22/h1-11,19H,12H2 |
| InChIKey | RWFSBMVISXEQNE-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 47.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.84 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |