C22H21F2N3O2S2 — CID 142980731
N-(2-aminoethyl)-6-[(2,5-difluorophenyl)-(4-methylphenyl)sulfonylmethyl]pyridine-3-carbothioamide (PubChem CID 142980731) has the molecular formula C22H21F2N3O2S2 and a molecular weight of 461.56 g/mol. Its IUPAC name is N-(2-aminoethyl)-6-[(2,5-difluorophenyl)-(4-methylphenyl)sulfonylmethyl]pyridine-3-carbothioamide.
| Compound Name | N-(2-aminoethyl)-6-[(2,5-difluorophenyl)-(4-methylphenyl)sulfonylmethyl]pyridine-3-carbothioamide |
|---|---|
| PubChem CID | 142980731 |
| Molecular Formula | C22H21F2N3O2S2 |
| Molecular Weight | 461.56 g/mol |
| Exact Mass | 461.10 |
| IUPAC Name | N-(2-aminoethyl)-6-[(2,5-difluorophenyl)-(4-methylphenyl)sulfonylmethyl]pyridine-3-carbothioamide |
| SMILES | Cc1ccc(S(=O)(=O)C(c2ccc(C(=S)NCCN)cn2)c2cc(F)ccc2F)cc1 |
| InChI | InChI=1S/C22H21F2N3O2S2/c1-14-2-6-17(7-3-14)31(28,29)21(18-12-16(23)5-8-19(18)24)20-9-4-15(13-27-20)22(30)26-11-10-25/h2-9,12-13,21H,10-11,25H2,1H3,(H,26,30) |
| InChIKey | IVAANCLJEASNPS-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 85.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.56 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|