C26H24F3NO3S — CID 163732417
1-[5-[(2,5-difluorophenyl)-(4-fluorophenyl)sulfonylmethyl]-4-methyl-2-pyridinyl]-2-methylhex-5-en-1-one (PubChem CID 163732417) has the molecular formula C26H24F3NO3S and a molecular weight of 487.54 g/mol. Its IUPAC name is 1-[5-[(2,5-difluorophenyl)-(4-fluorophenyl)sulfonylmethyl]-4-methyl-2-pyridinyl]-2-methylhex-5-en-1-one.
| Compound Name | 1-[5-[(2,5-difluorophenyl)-(4-fluorophenyl)sulfonylmethyl]-4-methyl-2-pyridinyl]-2-methylhex-5-en-1-one |
|---|---|
| PubChem CID | 163732417 |
| Molecular Formula | C26H24F3NO3S |
| Molecular Weight | 487.54 g/mol |
| Exact Mass | 487.14 |
| IUPAC Name | 1-[5-[(2,5-difluorophenyl)-(4-fluorophenyl)sulfonylmethyl]-4-methyl-2-pyridinyl]-2-methylhex-5-en-1-one |
| SMILES | C=CCCC(C)C(=O)c1cc(C)c(C(c2cc(F)ccc2F)S(=O)(=O)c2ccc(F)cc2)cn1 |
| InChI | InChI=1S/C26H24F3NO3S/c1-4-5-6-16(2)25(31)24-13-17(3)22(15-30-24)26(21-14-19(28)9-12-23(21)29)34(32,33)20-10-7-18(27)8-11-20/h4,7-16,26H,1,5-6H2,2-3H3 |
| InChIKey | LASUCZKOYWZOFN-UHFFFAOYSA-N |
| XLogP | 6.16 |
| TPSA | 64.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.54 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|