C21H24ClN3O — CID 70203042
(3S)-3-(1H-indol-3-ylmethyl)-1-(2-phenylethyl)piperazin-2-one;hydrochloride (PubChem CID 70203042) has the molecular formula C21H24ClN3O and a molecular weight of 369.90 g/mol. Its IUPAC name is (3S)-3-(1H-indol-3-ylmethyl)-1-(2-phenylethyl)piperazin-2-one;hydrochloride.
| Compound Name | (3S)-3-(1H-indol-3-ylmethyl)-1-(2-phenylethyl)piperazin-2-one;hydrochloride |
|---|---|
| PubChem CID | 70203042 |
| Molecular Formula | C21H24ClN3O |
| Molecular Weight | 369.90 g/mol |
| Exact Mass | 369.16 |
| IUPAC Name | (3S)-3-(1H-indol-3-ylmethyl)-1-(2-phenylethyl)piperazin-2-one;hydrochloride |
| SMILES | Cl.O=C1[C@H](Cc2c[nH]c3ccccc23)NCCN1CCc1ccccc1 |
| InChI | InChI=1S/C21H23N3O.ClH/c25-21-20(14-17-15-23-19-9-5-4-8-18(17)19)22-11-13-24(21)12-10-16-6-2-1-3-7-16;/h1-9,15,20,22-23H,10-14H2;1H/t20-;/m0./s1 |
| InChIKey | XQTVGLHPZUDUCJ-BDQAORGHSA-N |
| XLogP | 3.18 |
| TPSA | 48.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.90 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |