C30H34N4O — CID 22906956
1-[1-[benzyl(methyl)amino]-3-phenylpropan-2-yl]-3-(1H-indol-3-ylmethyl)piperazin-2-one (PubChem CID 22906956) has the molecular formula C30H34N4O and a molecular weight of 466.63 g/mol. Its IUPAC name is 1-[1-[benzyl(methyl)amino]-3-phenylpropan-2-yl]-3-(1H-indol-3-ylmethyl)piperazin-2-one.
| Compound Name | 1-[1-[benzyl(methyl)amino]-3-phenylpropan-2-yl]-3-(1H-indol-3-ylmethyl)piperazin-2-one |
|---|---|
| PubChem CID | 22906956 |
| Molecular Formula | C30H34N4O |
| Molecular Weight | 466.63 g/mol |
| Exact Mass | 466.27 |
| IUPAC Name | 1-[1-[benzyl(methyl)amino]-3-phenylpropan-2-yl]-3-(1H-indol-3-ylmethyl)piperazin-2-one |
| SMILES | CN(Cc1ccccc1)CC(Cc1ccccc1)N1CCNC(Cc2c[nH]c3ccccc23)C1=O |
| InChI | InChI=1S/C30H34N4O/c1-33(21-24-12-6-3-7-13-24)22-26(18-23-10-4-2-5-11-23)34-17-16-31-29(30(34)35)19-25-20-32-28-15-9-8-14-27(25)28/h2-15,20,26,29,31-32H,16-19,21-22H2,1H3 |
| InChIKey | IYAKBHVHGTXQCM-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 51.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.63 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |