C30H32N4O2 — CID 67634015
N-benzyl-2-[(3R)-3-(1H-indol-3-ylmethyl)-2-oxopiperazin-1-yl]-3-phenylbutanamide (PubChem CID 67634015) has the molecular formula C30H32N4O2 and a molecular weight of 480.61 g/mol. Its IUPAC name is N-benzyl-2-[(3R)-3-(1H-indol-3-ylmethyl)-2-oxopiperazin-1-yl]-3-phenylbutanamide.
| Compound Name | N-benzyl-2-[(3R)-3-(1H-indol-3-ylmethyl)-2-oxopiperazin-1-yl]-3-phenylbutanamide |
|---|---|
| PubChem CID | 67634015 |
| Molecular Formula | C30H32N4O2 |
| Molecular Weight | 480.61 g/mol |
| Exact Mass | 480.25 |
| IUPAC Name | N-benzyl-2-[(3R)-3-(1H-indol-3-ylmethyl)-2-oxopiperazin-1-yl]-3-phenylbutanamide |
| SMILES | CC(c1ccccc1)C(C(=O)NCc1ccccc1)N1CCN[C@H](Cc2c[nH]c3ccccc23)C1=O |
| InChI | InChI=1S/C30H32N4O2/c1-21(23-12-6-3-7-13-23)28(29(35)33-19-22-10-4-2-5-11-22)34-17-16-31-27(30(34)36)18-24-20-32-26-15-9-8-14-25(24)26/h2-15,20-21,27-28,31-32H,16-19H2,1H3,(H,33,35)/t21?,27-,28?/m1/s1 |
| InChIKey | LEMUGTQXNLDYSX-FJASEYGESA-N |
| XLogP | 4.00 |
| TPSA | 77.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.61 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |