C21H23N3O2 — CID 54467062
(3R)-1-[2-(3-hydroxyphenyl)ethyl]-3-(1H-indol-3-ylmethyl)piperazin-2-one (PubChem CID 54467062) has the molecular formula C21H23N3O2 and a molecular weight of 349.43 g/mol. Its IUPAC name is (3R)-1-[2-(3-hydroxyphenyl)ethyl]-3-(1H-indol-3-ylmethyl)piperazin-2-one.
| Compound Name | (3R)-1-[2-(3-hydroxyphenyl)ethyl]-3-(1H-indol-3-ylmethyl)piperazin-2-one |
|---|---|
| PubChem CID | 54467062 |
| Molecular Formula | C21H23N3O2 |
| Molecular Weight | 349.43 g/mol |
| Exact Mass | 349.18 |
| IUPAC Name | (3R)-1-[2-(3-hydroxyphenyl)ethyl]-3-(1H-indol-3-ylmethyl)piperazin-2-one |
| SMILES | O=C1[C@@H](Cc2c[nH]c3ccccc23)NCCN1CCc1cccc(O)c1 |
| InChI | InChI=1S/C21H23N3O2/c25-17-5-3-4-15(12-17)8-10-24-11-9-22-20(21(24)26)13-16-14-23-19-7-2-1-6-18(16)19/h1-7,12,14,20,22-23,25H,8-11,13H2/t20-/m1/s1 |
| InChIKey | XFQDNUXSRWFLKK-HXUWFJFHSA-N |
| XLogP | 2.46 |
| TPSA | 68.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.43 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |