C28H29N3O2 — CID 15391970
(3R)-3-(1H-indol-3-ylmethyl)-1-[2-(4-phenylmethoxyphenyl)ethyl]piperazin-2-one (PubChem CID 15391970) has the molecular formula C28H29N3O2 and a molecular weight of 439.56 g/mol. Its IUPAC name is (3R)-3-(1H-indol-3-ylmethyl)-1-[2-(4-phenylmethoxyphenyl)ethyl]piperazin-2-one.
| Compound Name | (3R)-3-(1H-indol-3-ylmethyl)-1-[2-(4-phenylmethoxyphenyl)ethyl]piperazin-2-one |
|---|---|
| PubChem CID | 15391970 |
| Molecular Formula | C28H29N3O2 |
| Molecular Weight | 439.56 g/mol |
| Exact Mass | 439.23 |
| IUPAC Name | (3R)-3-(1H-indol-3-ylmethyl)-1-[2-(4-phenylmethoxyphenyl)ethyl]piperazin-2-one |
| SMILES | O=C1[C@@H](Cc2c[nH]c3ccccc23)NCCN1CCc1ccc(OCc2ccccc2)cc1 |
| InChI | InChI=1S/C28H29N3O2/c32-28-27(18-23-19-30-26-9-5-4-8-25(23)26)29-15-17-31(28)16-14-21-10-12-24(13-11-21)33-20-22-6-2-1-3-7-22/h1-13,19,27,29-30H,14-18,20H2/t27-/m1/s1 |
| InChIKey | VBWPJWDQQQVGLC-HHHXNRCGSA-N |
| XLogP | 4.33 |
| TPSA | 57.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.56 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |