C35H40N6O5 — CID 131889572
(3S,6S,9S)-3-benzyl-13-[(3-hydroxyphenyl)methyl]-9-(1H-indol-3-ylmethyl)-6,7-dimethyl-1,4,7,10,13-pentazacyclopentadecane-2,5,8,11-tetrone (PubChem CID 131889572) has the molecular formula C35H40N6O5 and a molecular weight of 624.74 g/mol. Its IUPAC name is (3S,6S,9S)-3-benzyl-13-[(3-hydroxyphenyl)methyl]-9-(1H-indol-3-ylmethyl)-6,7-dimethyl-1,4,7,10,13-pentazacyclopentadecane-2,5,8,11-tetrone.
| Compound Name | (3S,6S,9S)-3-benzyl-13-[(3-hydroxyphenyl)methyl]-9-(1H-indol-3-ylmethyl)-6,7-dimethyl-1,4,7,10,13-pentazacyclopentadecane-2,5,8,11-tetrone |
|---|---|
| PubChem CID | 131889572 |
| Molecular Formula | C35H40N6O5 |
| Molecular Weight | 624.74 g/mol |
| Exact Mass | 624.31 |
| IUPAC Name | (3S,6S,9S)-3-benzyl-13-[(3-hydroxyphenyl)methyl]-9-(1H-indol-3-ylmethyl)-6,7-dimethyl-1,4,7,10,13-pentazacyclopentadecane-2,5,8,11-tetrone |
| SMILES | C[C@H]1C(=O)N[C@@H](Cc2ccccc2)C(=O)NCCN(Cc2cccc(O)c2)CC(=O)N[C@@H](Cc2c[nH]c3ccccc23)C(=O)N1C |
| InChI | InChI=1S/C35H40N6O5/c1-23-33(44)39-30(18-24-9-4-3-5-10-24)34(45)36-15-16-41(21-25-11-8-12-27(42)17-25)22-32(43)38-31(35(46)40(23)2)19-26-20-37-29-14-7-6-13-28(26)29/h3-14,17,20,23,30-31,37,42H,15-16,18-19,21-22H2,1-2H3,(H,36,45)(H,38,43)(H,39,44)/t23-,30-,31-/m0/s1 |
| InChIKey | LSENHKWKBVMEAE-ANZMCEIWSA-N |
| XLogP | 2.11 |
| TPSA | 146.87 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 624.74 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |