C28H41N7O4 — CID 131906370
(3S,6S,9S)-3-benzyl-6,7-dimethyl-13-[(1-methylimidazol-2-yl)methyl]-9-(2-methylpropyl)-1,4,7,10,13-pentazacyclopentadecane-2,5,8,11-tetrone (PubChem CID 131906370) has the molecular formula C28H41N7O4 and a molecular weight of 539.68 g/mol. Its IUPAC name is (3S,6S,9S)-3-benzyl-6,7-dimethyl-13-[(1-methylimidazol-2-yl)methyl]-9-(2-methylpropyl)-1,4,7,10,13-pentazacyclopentadecane-2,5,8,11-tetrone.
| Compound Name | (3S,6S,9S)-3-benzyl-6,7-dimethyl-13-[(1-methylimidazol-2-yl)methyl]-9-(2-methylpropyl)-1,4,7,10,13-pentazacyclopentadecane-2,5,8,11-tetrone |
|---|---|
| PubChem CID | 131906370 |
| Molecular Formula | C28H41N7O4 |
| Molecular Weight | 539.68 g/mol |
| Exact Mass | 539.32 |
| IUPAC Name | (3S,6S,9S)-3-benzyl-6,7-dimethyl-13-[(1-methylimidazol-2-yl)methyl]-9-(2-methylpropyl)-1,4,7,10,13-pentazacyclopentadecane-2,5,8,11-tetrone |
| SMILES | CC(C)C[C@@H]1NC(=O)CN(Cc2nccn2C)CCNC(=O)[C@H](Cc2ccccc2)NC(=O)[C@H](C)N(C)C1=O |
| InChI | InChI=1S/C28H41N7O4/c1-19(2)15-23-28(39)34(5)20(3)26(37)32-22(16-21-9-7-6-8-10-21)27(38)30-12-14-35(18-25(36)31-23)17-24-29-11-13-33(24)4/h6-11,13,19-20,22-23H,12,14-18H2,1-5H3,(H,30,38)(H,31,36)(H,32,37)/t20-,22-,23-/m0/s1 |
| InChIKey | LQVXEMBBBNHUNC-PMVMPFDFSA-N |
| XLogP | 0.46 |
| TPSA | 128.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.68 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |