C29H46N6O5 — CID 135102383
(3S,6R,9S,12S,18S)-18-benzyl-6,9,10-trimethyl-12-(2-methylpropyl)-3-propan-2-yl-1,4,7,10,13,16-hexazacyclooctadecane-2,5,8,11,14-pentone (PubChem CID 135102383) has the molecular formula C29H46N6O5 and a molecular weight of 558.72 g/mol. Its IUPAC name is (3S,6R,9S,12S,18S)-18-benzyl-6,9,10-trimethyl-12-(2-methylpropyl)-3-propan-2-yl-1,4,7,10,13,16-hexazacyclooctadecane-2,5,8,11,14-pentone.
| Compound Name | (3S,6R,9S,12S,18S)-18-benzyl-6,9,10-trimethyl-12-(2-methylpropyl)-3-propan-2-yl-1,4,7,10,13,16-hexazacyclooctadecane-2,5,8,11,14-pentone |
|---|---|
| PubChem CID | 135102383 |
| Molecular Formula | C29H46N6O5 |
| Molecular Weight | 558.72 g/mol |
| Exact Mass | 558.35 |
| IUPAC Name | (3S,6R,9S,12S,18S)-18-benzyl-6,9,10-trimethyl-12-(2-methylpropyl)-3-propan-2-yl-1,4,7,10,13,16-hexazacyclooctadecane-2,5,8,11,14-pentone |
| SMILES | CC(C)C[C@@H]1NC(=O)CNC[C@H](Cc2ccccc2)NC(=O)[C@H](C(C)C)NC(=O)[C@@H](C)NC(=O)[C@H](C)N(C)C1=O |
| InChI | InChI=1S/C29H46N6O5/c1-17(2)13-23-29(40)35(7)20(6)27(38)31-19(5)26(37)34-25(18(3)4)28(39)32-22(15-30-16-24(36)33-23)14-21-11-9-8-10-12-21/h8-12,17-20,22-23,25,30H,13-16H2,1-7H3,(H,31,38)(H,32,39)(H,33,36)(H,34,37)/t19-,20+,22+,23+,25+/m1/s1 |
| InChIKey | RIUBSUOZSPAHKK-WGWBVWISSA-N |
| XLogP | 0.34 |
| TPSA | 148.74 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.72 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |