C30H46N6O5 — CID 131919608
(3S,6S,9S)-3-benzyl-6,7-dimethyl-13-(1-methylpiperidine-4-carbonyl)-9-(2-methylpropyl)-1,4,7,10,13-pentazacyclopentadecane-2,5,8,11-tetrone (PubChem CID 131919608) has the molecular formula C30H46N6O5 and a molecular weight of 570.74 g/mol. Its IUPAC name is (3S,6S,9S)-3-benzyl-6,7-dimethyl-13-(1-methylpiperidine-4-carbonyl)-9-(2-methylpropyl)-1,4,7,10,13-pentazacyclopentadecane-2,5,8,11-tetrone.
| Compound Name | (3S,6S,9S)-3-benzyl-6,7-dimethyl-13-(1-methylpiperidine-4-carbonyl)-9-(2-methylpropyl)-1,4,7,10,13-pentazacyclopentadecane-2,5,8,11-tetrone |
|---|---|
| PubChem CID | 131919608 |
| Molecular Formula | C30H46N6O5 |
| Molecular Weight | 570.74 g/mol |
| Exact Mass | 570.35 |
| IUPAC Name | (3S,6S,9S)-3-benzyl-6,7-dimethyl-13-(1-methylpiperidine-4-carbonyl)-9-(2-methylpropyl)-1,4,7,10,13-pentazacyclopentadecane-2,5,8,11-tetrone |
| SMILES | CC(C)C[C@@H]1NC(=O)CN(C(=O)C2CCN(C)CC2)CCNC(=O)[C@H](Cc2ccccc2)NC(=O)[C@H](C)N(C)C1=O |
| InChI | InChI=1S/C30H46N6O5/c1-20(2)17-25-30(41)35(5)21(3)27(38)33-24(18-22-9-7-6-8-10-22)28(39)31-13-16-36(19-26(37)32-25)29(40)23-11-14-34(4)15-12-23/h6-10,20-21,23-25H,11-19H2,1-5H3,(H,31,39)(H,32,37)(H,33,38)/t21-,24-,25-/m0/s1 |
| InChIKey | ZYMMEAOJAXAFLW-TUSQITKMSA-N |
| XLogP | 0.39 |
| TPSA | 131.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.74 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |