C33H51N5O7 — CID 135095878
(2R,5S,8S)-5-[(4-methoxyphenyl)methyl]-7,8-dimethyl-2-(2-methylpropyl)-14-(oxane-4-carbonyl)-1,4,7,10,14-pentazacyclooctadecane-3,6,9,18-tetrone (PubChem CID 135095878) has the molecular formula C33H51N5O7 and a molecular weight of 629.80 g/mol. Its IUPAC name is (2R,5S,8S)-5-[(4-methoxyphenyl)methyl]-7,8-dimethyl-2-(2-methylpropyl)-14-(oxane-4-carbonyl)-1,4,7,10,14-pentazacyclooctadecane-3,6,9,18-tetrone.
| Compound Name | (2R,5S,8S)-5-[(4-methoxyphenyl)methyl]-7,8-dimethyl-2-(2-methylpropyl)-14-(oxane-4-carbonyl)-1,4,7,10,14-pentazacyclooctadecane-3,6,9,18-tetrone |
|---|---|
| PubChem CID | 135095878 |
| Molecular Formula | C33H51N5O7 |
| Molecular Weight | 629.80 g/mol |
| Exact Mass | 629.38 |
| IUPAC Name | (2R,5S,8S)-5-[(4-methoxyphenyl)methyl]-7,8-dimethyl-2-(2-methylpropyl)-14-(oxane-4-carbonyl)-1,4,7,10,14-pentazacyclooctadecane-3,6,9,18-tetrone |
| SMILES | COc1ccc(C[C@@H]2NC(=O)[C@@H](CC(C)C)NC(=O)CCCN(C(=O)C3CCOCC3)CCCNC(=O)[C@H](C)N(C)C2=O)cc1 |
| InChI | InChI=1S/C33H51N5O7/c1-22(2)20-27-31(41)36-28(21-24-9-11-26(44-5)12-10-24)33(43)37(4)23(3)30(40)34-15-7-17-38(16-6-8-29(39)35-27)32(42)25-13-18-45-19-14-25/h9-12,22-23,25,27-28H,6-8,13-21H2,1-5H3,(H,34,40)(H,35,39)(H,36,41)/t23-,27+,28-/m0/s1 |
| InChIKey | SSSMHDOXFURPLV-LBNPDIFZSA-N |
| XLogP | 1.66 |
| TPSA | 146.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 629.80 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |