C31H42N4O5S — CID 135105869
trans-(2S,5S)-11-(3-benzylsulfanylpropanoyl)-2-[(4-methoxyphenyl)methyl]-4,5-dimethyl-1,4,7,11-tetrazacyclopentadecane-3,6,15-trione (PubChem CID 135105869) has the molecular formula C31H42N4O5S and a molecular weight of 582.77 g/mol. Its IUPAC name is trans-(2S,5S)-11-(3-benzylsulfanylpropanoyl)-2-[(4-methoxyphenyl)methyl]-4,5-dimethyl-1,4,7,11-tetrazacyclopentadecane-3,6,15-trione.
| Compound Name | trans-(2S,5S)-11-(3-benzylsulfanylpropanoyl)-2-[(4-methoxyphenyl)methyl]-4,5-dimethyl-1,4,7,11-tetrazacyclopentadecane-3,6,15-trione |
|---|---|
| PubChem CID | 135105869 |
| Molecular Formula | C31H42N4O5S |
| Molecular Weight | 582.77 g/mol |
| Exact Mass | 582.29 |
| IUPAC Name | trans-(2S,5S)-11-(3-benzylsulfanylpropanoyl)-2-[(4-methoxyphenyl)methyl]-4,5-dimethyl-1,4,7,11-tetrazacyclopentadecane-3,6,15-trione |
| SMILES | COc1ccc(C[C@@H]2NC(=O)CCCN(C(=O)CCSCc3ccccc3)CCCNC(=O)[C@H](C)N(C)C2=O)cc1 |
| InChI | InChI=1S/C31H42N4O5S/c1-23-30(38)32-17-8-19-35(29(37)16-20-41-22-25-9-5-4-6-10-25)18-7-11-28(36)33-27(31(39)34(23)2)21-24-12-14-26(40-3)15-13-24/h4-6,9-10,12-15,23,27H,7-8,11,16-22H2,1-3H3,(H,32,38)(H,33,36)/t23-,27-/m0/s1 |
| InChIKey | MHKSUZGSUXAKTI-HOFKKMOUSA-N |
| XLogP | 3.02 |
| TPSA | 108.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.77 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|