C36H43FN4O5 — CID 135096495
trans-(2S,5S)-11-[2-[(3-fluoro-4-methylphenyl)methyl]benzoyl]-2-[(4-methoxyphenyl)methyl]-4,5-dimethyl-1,4,7,11-tetrazacyclopentadecane-3,6,15-trione (PubChem CID 135096495) has the molecular formula C36H43FN4O5 and a molecular weight of 630.76 g/mol. Its IUPAC name is trans-(2S,5S)-11-[2-[(3-fluoro-4-methylphenyl)methyl]benzoyl]-2-[(4-methoxyphenyl)methyl]-4,5-dimethyl-1,4,7,11-tetrazacyclopentadecane-3,6,15-trione.
| Compound Name | trans-(2S,5S)-11-[2-[(3-fluoro-4-methylphenyl)methyl]benzoyl]-2-[(4-methoxyphenyl)methyl]-4,5-dimethyl-1,4,7,11-tetrazacyclopentadecane-3,6,15-trione |
|---|---|
| PubChem CID | 135096495 |
| Molecular Formula | C36H43FN4O5 |
| Molecular Weight | 630.76 g/mol |
| Exact Mass | 630.32 |
| IUPAC Name | trans-(2S,5S)-11-[2-[(3-fluoro-4-methylphenyl)methyl]benzoyl]-2-[(4-methoxyphenyl)methyl]-4,5-dimethyl-1,4,7,11-tetrazacyclopentadecane-3,6,15-trione |
| SMILES | COc1ccc(C[C@@H]2NC(=O)CCCN(C(=O)c3ccccc3Cc3ccc(C)c(F)c3)CCCNC(=O)[C@H](C)N(C)C2=O)cc1 |
| InChI | InChI=1S/C36H43FN4O5/c1-24-12-13-27(22-31(24)37)21-28-9-5-6-10-30(28)35(44)41-19-7-11-33(42)39-32(23-26-14-16-29(46-4)17-15-26)36(45)40(3)25(2)34(43)38-18-8-20-41/h5-6,9-10,12-17,22,25,32H,7-8,11,18-21,23H2,1-4H3,(H,38,43)(H,39,42)/t25-,32-/m0/s1 |
| InChIKey | BGNTUPCDASMGTD-UKJJDJLKSA-N |
| XLogP | 4.05 |
| TPSA | 108.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 630.76 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |