C29H35N5O5S2 — CID 135107866
trans-(2S,5S)-2-[(4-methoxyphenyl)methyl]-4,5-dimethyl-11-(2-thiophen-2-yl-1,3-thiazole-4-carbonyl)-1,4,7,11-tetrazacyclopentadecane-3,6,15-trione (PubChem CID 135107866) has the molecular formula C29H35N5O5S2 and a molecular weight of 597.76 g/mol. Its IUPAC name is trans-(2S,5S)-2-[(4-methoxyphenyl)methyl]-4,5-dimethyl-11-(2-thiophen-2-yl-1,3-thiazole-4-carbonyl)-1,4,7,11-tetrazacyclopentadecane-3,6,15-trione.
| Compound Name | trans-(2S,5S)-2-[(4-methoxyphenyl)methyl]-4,5-dimethyl-11-(2-thiophen-2-yl-1,3-thiazole-4-carbonyl)-1,4,7,11-tetrazacyclopentadecane-3,6,15-trione |
|---|---|
| PubChem CID | 135107866 |
| Molecular Formula | C29H35N5O5S2 |
| Molecular Weight | 597.76 g/mol |
| Exact Mass | 597.21 |
| IUPAC Name | trans-(2S,5S)-2-[(4-methoxyphenyl)methyl]-4,5-dimethyl-11-(2-thiophen-2-yl-1,3-thiazole-4-carbonyl)-1,4,7,11-tetrazacyclopentadecane-3,6,15-trione |
| SMILES | COc1ccc(C[C@@H]2NC(=O)CCCN(C(=O)c3csc(-c4cccs4)n3)CCCNC(=O)[C@H](C)N(C)C2=O)cc1 |
| InChI | InChI=1S/C29H35N5O5S2/c1-19-26(36)30-13-6-15-34(29(38)23-18-41-27(32-23)24-7-5-16-40-24)14-4-8-25(35)31-22(28(37)33(19)2)17-20-9-11-21(39-3)12-10-20/h5,7,9-12,16,18-19,22H,4,6,8,13-15,17H2,1-3H3,(H,30,36)(H,31,35)/t19-,22-/m0/s1 |
| InChIKey | ILRBNKYKDDBDGE-UGKGYDQZSA-N |
| XLogP | 3.20 |
| TPSA | 120.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 597.76 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |