C35H46N6O6S — CID 135103524
(2R,5S,8S)-14-(1,3-benzothiazole-6-carbonyl)-5-[(4-methoxyphenyl)methyl]-7,8-dimethyl-2-(2-methylpropyl)-1,4,7,10,14-pentazacyclooctadecane-3,6,9,18-tetrone (PubChem CID 135103524) has the molecular formula C35H46N6O6S and a molecular weight of 678.86 g/mol. Its IUPAC name is (2R,5S,8S)-14-(1,3-benzothiazole-6-carbonyl)-5-[(4-methoxyphenyl)methyl]-7,8-dimethyl-2-(2-methylpropyl)-1,4,7,10,14-pentazacyclooctadecane-3,6,9,18-tetrone.
| Compound Name | (2R,5S,8S)-14-(1,3-benzothiazole-6-carbonyl)-5-[(4-methoxyphenyl)methyl]-7,8-dimethyl-2-(2-methylpropyl)-1,4,7,10,14-pentazacyclooctadecane-3,6,9,18-tetrone |
|---|---|
| PubChem CID | 135103524 |
| Molecular Formula | C35H46N6O6S |
| Molecular Weight | 678.86 g/mol |
| Exact Mass | 678.32 |
| IUPAC Name | (2R,5S,8S)-14-(1,3-benzothiazole-6-carbonyl)-5-[(4-methoxyphenyl)methyl]-7,8-dimethyl-2-(2-methylpropyl)-1,4,7,10,14-pentazacyclooctadecane-3,6,9,18-tetrone |
| SMILES | COc1ccc(C[C@@H]2NC(=O)[C@@H](CC(C)C)NC(=O)CCCN(C(=O)c3ccc4ncsc4c3)CCCNC(=O)[C@H](C)N(C)C2=O)cc1 |
| InChI | InChI=1S/C35H46N6O6S/c1-22(2)18-28-33(44)39-29(19-24-9-12-26(47-5)13-10-24)35(46)40(4)23(3)32(43)36-15-7-17-41(16-6-8-31(42)38-28)34(45)25-11-14-27-30(20-25)48-21-37-27/h9-14,20-23,28-29H,6-8,15-19H2,1-5H3,(H,36,43)(H,38,42)(H,39,44)/t23-,28+,29-/m0/s1 |
| InChIKey | TZPMOFQYOCNLDN-QKZGOTKPSA-N |
| XLogP | 3.15 |
| TPSA | 150.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 48 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 678.86 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |