C26H34F2N6O5 — CID 135088117
trans-(2S,5S)-11-[1-(difluoromethyl)pyrazole-3-carbonyl]-2-[(4-methoxyphenyl)methyl]-4,5-dimethyl-1,4,7,11-tetrazacyclopentadecane-3,6,15-trione (PubChem CID 135088117) has the molecular formula C26H34F2N6O5 and a molecular weight of 548.59 g/mol. Its IUPAC name is trans-(2S,5S)-11-[1-(difluoromethyl)pyrazole-3-carbonyl]-2-[(4-methoxyphenyl)methyl]-4,5-dimethyl-1,4,7,11-tetrazacyclopentadecane-3,6,15-trione.
| Compound Name | trans-(2S,5S)-11-[1-(difluoromethyl)pyrazole-3-carbonyl]-2-[(4-methoxyphenyl)methyl]-4,5-dimethyl-1,4,7,11-tetrazacyclopentadecane-3,6,15-trione |
|---|---|
| PubChem CID | 135088117 |
| Molecular Formula | C26H34F2N6O5 |
| Molecular Weight | 548.59 g/mol |
| Exact Mass | 548.26 |
| IUPAC Name | trans-(2S,5S)-11-[1-(difluoromethyl)pyrazole-3-carbonyl]-2-[(4-methoxyphenyl)methyl]-4,5-dimethyl-1,4,7,11-tetrazacyclopentadecane-3,6,15-trione |
| SMILES | COc1ccc(C[C@@H]2NC(=O)CCCN(C(=O)c3ccn(C(F)F)n3)CCCNC(=O)[C@H](C)N(C)C2=O)cc1 |
| InChI | InChI=1S/C26H34F2N6O5/c1-17-23(36)29-12-5-14-33(25(38)20-11-15-34(31-20)26(27)28)13-4-6-22(35)30-21(24(37)32(17)2)16-18-7-9-19(39-3)10-8-18/h7-11,15,17,21,26H,4-6,12-14,16H2,1-3H3,(H,29,36)(H,30,35)/t17-,21-/m0/s1 |
| InChIKey | HNGPRKJHVJASAA-UWJYYQICSA-N |
| XLogP | 1.60 |
| TPSA | 125.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.59 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |